![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
1000 Aeroplanes Crashing in the Night | 20-Apr-2018 16:20 | - | |
|
20 Dead Flower Children | 20-Apr-2018 16:20 | - | |
|
4volt | 20-Apr-2018 16:20 | - | |
|
5ème Dimension | 20-Apr-2018 16:20 | - | |
|
7dayBinge | 20-Apr-2018 16:20 | - | |
|
A Fistful of Dynamite | 20-Apr-2018 16:20 | - | |
|
A Perfect Day | 20-Apr-2018 16:20 | - | |
|
Abadawn | 20-Apr-2018 16:20 | - | |
|
Adama Diabate | 20-Apr-2018 16:20 | - | |
|
Advocate | 20-Apr-2018 16:20 | - | |
|
Ainigma | 20-Apr-2018 16:20 | - | |
|
Air Review | 20-Apr-2018 16:20 | - | |
|
Alexl | 20-Apr-2018 16:20 | - | |
|
Alicia | 20-Apr-2018 16:20 | - | |
|
Amphora | 20-Apr-2018 16:20 | - | |
|
Angela Kelly | 20-Apr-2018 16:20 | - | |
|
Anne Wolf | 20-Apr-2018 16:20 | - | |
|
Anthony Braxton ⁄ György Szabados ⁄ Vladimir Tarasov | 20-Apr-2018 16:20 | - | |
|
Assassins of Sound | 20-Apr-2018 16:20 | - | |
|
Assert | 20-Apr-2018 16:20 | - | |
|
Aztec Two-Step | 20-Apr-2018 16:20 | - | |
|
B.A.Y. (Bay Area Youngstas) | 20-Apr-2018 16:20 | - | |
|
Babatunde Lea | 20-Apr-2018 16:20 | - | |
|
Babe | 20-Apr-2018 16:20 | - | |
|
Baby et Lulu | 20-Apr-2018 16:20 | - | |
|
Balsa Gliders | 20-Apr-2018 16:20 | - | |
|
Bass Bombers | 20-Apr-2018 16:20 | - | |
|
Bastard Sons of Apocalypse | 20-Apr-2018 16:20 | - | |
|
Beth Leachman & Margot Krimmel | 20-Apr-2018 16:20 | - | |
|
Bitistål | 20-Apr-2018 16:20 | - | |
|
Blas y las Astrales | 20-Apr-2018 16:20 | - | |
|
Blast Furnace & The Heatwaves | 20-Apr-2018 16:20 | - | |
|
Blendbrank | 20-Apr-2018 16:20 | - | |
|
Boricuas N.Y. 2 | 20-Apr-2018 16:20 | - | |
|
Buddhist Monks of Maitri Vihar Monastery | 20-Apr-2018 16:20 | - | |
|
Buenos Aires 8 | 20-Apr-2018 16:20 | - | |
|
CATAIA | 20-Apr-2018 16:20 | - | |
|
CLP | 20-Apr-2018 16:20 | - | |
|
Carreiro | 20-Apr-2018 16:20 | - | |
|
Chemical Drive | 20-Apr-2018 16:20 | - | |
|
Christian Spering | 20-Apr-2018 16:20 | - | |
|
Codesuma | 20-Apr-2018 16:20 | - | |
|
Compostela | 20-Apr-2018 16:20 | - | |
|
Conrad Newholmes | 20-Apr-2018 16:20 | - | |
|
Crossfire | 20-Apr-2018 16:20 | - | |
|
DDR | 20-Apr-2018 16:20 | - | |
|
DJ Brigz | 20-Apr-2018 16:20 | - | |
|
DJ Pacecord | 20-Apr-2018 16:20 | - | |
|
Damned Pilots | 20-Apr-2018 16:20 | - | |
|
Danse Macabre | 20-Apr-2018 16:20 | - | |
|
Deep Image | 20-Apr-2018 16:20 | - | |
|
Didier Marouani | 20-Apr-2018 16:20 | - | |
|
Dissident Saint | 20-Apr-2018 16:20 | - | |
|
Dornröschen | 20-Apr-2018 16:20 | - | |
|
Dr Doom | 20-Apr-2018 16:20 | - | |
|
Drake | 20-Apr-2018 16:20 | - | |
|
Droidlock | 20-Apr-2018 16:20 | - | |
|
Duck. Little Brother, Duck! | 20-Apr-2018 16:20 | - | |
|
Dunderbeist | 20-Apr-2018 16:20 | - | |
|
EBN | 20-Apr-2018 16:20 | - | |
|
EXPØ | 20-Apr-2018 16:20 | - | |
|
Eclipse | 20-Apr-2018 16:20 | - | |
|
Econocon | 20-Apr-2018 16:20 | - | |
|
Eedris Abdulkareem | 20-Apr-2018 16:20 | - | |
|
El Gusto Orchestra | 20-Apr-2018 16:20 | - | |
|
Elasticdeath | 20-Apr-2018 16:20 | - | |
|
Elle s'appelle | 20-Apr-2018 16:20 | - | |
|
Elzevir | 20-Apr-2018 16:20 | - | |
|
Endlos | 20-Apr-2018 16:20 | - | |
|
Enur feat. Natasja | 20-Apr-2018 16:20 | - | |
|
Eric Tingstad & Nancy Rumbel | 20-Apr-2018 16:20 | - | |
|
Error 404 | 20-Apr-2018 16:20 | - | |
|
Eternal Tango | 20-Apr-2018 16:20 | - | |
|
Eternity | 20-Apr-2018 16:20 | - | |
|
Eugene Friesen & Paul Halley | 20-Apr-2018 16:20 | - | |
|
Evil Men Have No Songs | 20-Apr-2018 16:20 | - | |
|
Felix De Luca | 20-Apr-2018 16:20 | - | |
|
Ferne | 20-Apr-2018 16:20 | - | |
|
Fi-Lo Radio | 20-Apr-2018 16:20 | - | |
|
Filó Machado | 20-Apr-2018 16:20 | - | |
|
Floyd Lee | 20-Apr-2018 16:20 | - | |
|
Francisco Alves & Mário Reis | 20-Apr-2018 16:20 | - | |
|
Fred Irwin | 20-Apr-2018 16:20 | - | |
|
Genghis Angus | 20-Apr-2018 16:20 | - | |
|
Gilles | 20-Apr-2018 16:20 | - | |
|
Governor Bolts | 20-Apr-2018 16:20 | - | |
|
Grandpa Elliott | 20-Apr-2018 16:20 | - | |
|
Green Haze | 20-Apr-2018 16:20 | - | |
|
Grizu | 20-Apr-2018 16:20 | - | |
|
Ground Control | 20-Apr-2018 16:20 | - | |
|
Grupo Elo | 20-Apr-2018 16:20 | - | |
|
Gunther Levi | 20-Apr-2018 16:20 | - | |
|
Harold Rayford | 20-Apr-2018 16:20 | - | |
|
Harry Perry | 20-Apr-2018 16:20 | - | |
|
Harry Tavitian and Hans Kumpf | 20-Apr-2018 16:20 | - | |
|
Heat Dust | 20-Apr-2018 16:20 | - | |
|
Howard Prince & the Music Coalition | 20-Apr-2018 16:20 | - | |
|
I Need? | 20-Apr-2018 16:20 | - | |
|
Il giardino violetto | 20-Apr-2018 16:20 | - | |
|
Isaac's Aircraft | 20-Apr-2018 16:20 | - | |
|
Jack Payne | 20-Apr-2018 16:20 | - | |
|
Jacques & Micheline Pelzer Quartet | 20-Apr-2018 16:20 | - | |
|
Janaynna | 20-Apr-2018 16:20 | - | |
|
Jeff Sova | 20-Apr-2018 16:20 | - | |
|
Jenn Mierau | 20-Apr-2018 16:20 | - | |
|
Junior A Lewis | 20-Apr-2018 16:20 | - | |
|
Just Add Water | 20-Apr-2018 16:20 | - | |
|
Karl Phillips & The Midnight Ramblers | 20-Apr-2018 16:20 | - | |
|
Kelompok Sunda | 20-Apr-2018 16:20 | - | |
|
Kid Acne | 20-Apr-2018 16:20 | - | |
|
Klockworks | 20-Apr-2018 16:20 | - | |
|
Knut Hamre | 20-Apr-2018 16:20 | - | |
|
Kürten | 20-Apr-2018 16:20 | - | |
|
L'Oniraunote | 20-Apr-2018 16:20 | - | |
|
La Carrau | 20-Apr-2018 16:20 | - | |
|
La Trabant | 20-Apr-2018 16:20 | - | |
|
Ladybird Unition | 20-Apr-2018 16:20 | - | |
|
Leningrad Dixieland Band | 20-Apr-2018 16:20 | - | |
|
Liam Dinsmore | 20-Apr-2018 16:20 | - | |
|
Lindsay May | 20-Apr-2018 16:20 | - | |
|
Lorenz Maierhofer | 20-Apr-2018 16:20 | - | |
|
Mach & Jesse | 20-Apr-2018 16:20 | - | |
|
Manou Gallo | 20-Apr-2018 16:20 | - | |
|
Mapumblugh | 20-Apr-2018 16:20 | - | |
|
Martha Wash feat. RuPaul | 20-Apr-2018 16:20 | - | |
|
Mega-Kids | 20-Apr-2018 16:20 | - | |
|
Michaux | 20-Apr-2018 16:20 | - | |
|
Mike Batio, Rob Ross | 20-Apr-2018 16:20 | - | |
|
Minus The Tiger | 20-Apr-2018 16:20 | - | |
|
Mitto | 20-Apr-2018 16:20 | - | |
|
Modern Witch | 20-Apr-2018 16:20 | - | |
|
Moonwatcher | 20-Apr-2018 16:20 | - | |
|
Mord | 20-Apr-2018 16:20 | - | |
|
Mortal Agony | 20-Apr-2018 16:20 | - | |
|
Moth Vellum | 20-Apr-2018 16:20 | - | |
|
Moussas Farm | 20-Apr-2018 16:20 | - | |
|
Myron Cohen | 20-Apr-2018 16:20 | - | |
|
Mélanie Auclair | 20-Apr-2018 16:20 | - | |
|
N.A.M.E | 20-Apr-2018 16:20 | - | |
|
Navvy | 20-Apr-2018 16:20 | - | |
|
Nebucadnezzer | 20-Apr-2018 16:20 | - | |
|
Neil Howard | 20-Apr-2018 16:20 | - | |
|
Niño | 20-Apr-2018 16:20 | - | |
|
Nothnegal | 20-Apr-2018 16:20 | - | |
|
Oblisk | 20-Apr-2018 16:20 | - | |
|
Opiate for the Masses | 20-Apr-2018 16:20 | - | |
|
Otis Grand & The Dance Kings | 20-Apr-2018 16:20 | - | |
|
PEVO | 20-Apr-2018 16:20 | - | |
|
Paul Motian and the Electric Bebop Band | 20-Apr-2018 16:20 | - | |
|
Periko Plazer | 20-Apr-2018 16:20 | - | |
|
Peter Presta | 20-Apr-2018 16:20 | - | |
|
Peter Sobot | 20-Apr-2018 16:20 | - | |
|
Pickled Dogg | 20-Apr-2018 16:20 | - | |
|
Piloo Bhattacharya | 20-Apr-2018 16:20 | - | |
|
Pitbull feat. Afrojack | 20-Apr-2018 16:20 | - | |
|
Pitch Black | 20-Apr-2018 16:20 | - | |
|
Poetrip | 20-Apr-2018 16:20 | - | |
|
Power Francers & D-Bag | 20-Apr-2018 16:20 | - | |
|
Power Francers vs. D-Bag | 20-Apr-2018 16:20 | - | |
|
Puzzlebox | 20-Apr-2018 16:20 | - | |
|
Rasel feat. Carlos Baute | 20-Apr-2018 16:20 | - | |
|
Rasmus Klump og hans venner | 20-Apr-2018 16:20 | - | |
|
Redds & The Boys | 20-Apr-2018 16:20 | - | |
|
Reviolence | 20-Apr-2018 16:20 | - | |
|
Rich Creamy Paint | 20-Apr-2018 16:20 | - | |
|
Ritmika | 20-Apr-2018 16:20 | - | |
|
Riverdance | 20-Apr-2018 16:20 | - | |
|
Roald Zahl | 20-Apr-2018 16:20 | - | |
|
Rod Stinson | 20-Apr-2018 16:20 | - | |
|
Rollinghead | 20-Apr-2018 16:20 | - | |
|
Rotdorn | 20-Apr-2018 16:20 | - | |
|
Runnica | 20-Apr-2018 16:20 | - | |
|
Russ Lossing | 20-Apr-2018 16:20 | - | |
|
Rye Rye | 20-Apr-2018 16:20 | - | |
|
SDN48 | 20-Apr-2018 16:20 | - | |
|
Sabonetes | 20-Apr-2018 16:20 | - | |
|
Samúel Jón Samúelsson | 20-Apr-2018 16:20 | - | |
|
Santogold feat. Three 6 Mafia & Project Pat | 20-Apr-2018 16:20 | - | |
|
Saskia & Serge | 20-Apr-2018 16:20 | - | |
|
Scary Mansion | 20-Apr-2018 16:20 | - | |
|
Shikh Saad Al-Ghamdy | 20-Apr-2018 16:20 | - | |
|
Shirley McNeal, Ph.D. | 20-Apr-2018 16:20 | - | |
|
Simon Russell | 20-Apr-2018 16:20 | - | |
|
Single Helix | 20-Apr-2018 16:20 | - | |
|
Sinsheen | 20-Apr-2018 16:20 | - | |
|
Skull | 20-Apr-2018 16:20 | - | |
|
Skursula | 20-Apr-2018 16:20 | - | |
|
Snagga Puss | 20-Apr-2018 16:20 | - | |
|
Sombrero Vueltiao | 20-Apr-2018 16:20 | - | |
|
Something Odd | 20-Apr-2018 16:20 | - | |
|
Spencer the Rover | 20-Apr-2018 16:20 | - | |
|
Spirit Guide | 20-Apr-2018 16:20 | - | |
|
Steel Testament | 20-Apr-2018 16:20 | - | |
|
Stef Bos & Bob Savenberg | 20-Apr-2018 16:20 | - | |
|
Stephanie Bentley | 20-Apr-2018 16:20 | - | |
|
Supervision | 20-Apr-2018 16:20 | - | |
|
Sweet Love | 20-Apr-2018 16:20 | - | |
|
T-Quest | 20-Apr-2018 16:20 | - | |
|
TMDP | 20-Apr-2018 16:20 | - | |
|
Technossomy | 20-Apr-2018 16:20 | - | |
|
Terry White Big Band | 20-Apr-2018 16:20 | - | |
|
The Brigade | 20-Apr-2018 16:20 | - | |
|
The Infamous Shoeless Joe | 20-Apr-2018 16:20 | - | |
|
The Khan Brothers | 20-Apr-2018 16:20 | - | |
|
The Kreeg | 20-Apr-2018 16:20 | - | |
|
The National Bank | 20-Apr-2018 16:20 | - | |
|
The New Shapes | 20-Apr-2018 16:20 | - | |
|
The New York Fund | 20-Apr-2018 16:20 | - | |
|
The Newtown Grunts | 20-Apr-2018 16:20 | - | |
|
The Outfit | 20-Apr-2018 16:20 | - | |
|
The Shelley Winters Project | 20-Apr-2018 16:20 | - | |
|
The Steve Tenpenny Band | 20-Apr-2018 16:20 | - | |
|
The Thieves | 20-Apr-2018 16:20 | - | |
|
The Third Planet | 20-Apr-2018 16:20 | - | |
|
The Vandervoorts | 20-Apr-2018 16:20 | - | |
|
The Vigilantes | 20-Apr-2018 16:20 | - | |
|
Thee Letting Forth of Fire | 20-Apr-2018 16:20 | - | |
|
Timmy & Tommy | 20-Apr-2018 16:20 | - | |
|
Tiramisú | 20-Apr-2018 16:20 | - | |
|
To What End? | 20-Apr-2018 16:20 | - | |
|
Tortuga | 20-Apr-2018 16:20 | - | |
|
Trancelike Void | 20-Apr-2018 16:20 | - | |
|
Transcender | 20-Apr-2018 16:20 | - | |
|
Trio Soulaÿrès | 20-Apr-2018 16:20 | - | |
|
Urauschwitz | 20-Apr-2018 16:20 | - | |
|
Velocity Boy | 20-Apr-2018 16:20 | - | |
|
Virpi Piippo | 20-Apr-2018 16:20 | - | |
|
Vomit Launch | 20-Apr-2018 16:20 | - | |
|
Von Südenfed | 20-Apr-2018 16:20 | - | |
|
Wes Burden | 20-Apr-2018 16:20 | - | |
|
Wither | 20-Apr-2018 16:20 | - | |
|
Wyatt | 20-Apr-2018 16:20 | - | |
|
ZOO | 20-Apr-2018 16:20 | - | |
|
Zilch | 20-Apr-2018 16:20 | - | |
|
Zom Zoms | 20-Apr-2018 16:20 | - | |
|
Zé Miguel Wisnik | 20-Apr-2018 16:20 | - | |
|
av3rs1on | 20-Apr-2018 16:20 | - | |
|
e-rax | 20-Apr-2018 16:20 | - | |
|
emvelope nine | 20-Apr-2018 16:20 | - | |
|
forbidden days rhapsody | 20-Apr-2018 16:20 | - | |
|
in*digna | 20-Apr-2018 16:20 | - | |
|
starfish64 | 20-Apr-2018 16:20 | - | |
|
Élage Diouf | 20-Apr-2018 16:20 | - | |
|
Θάνος Μικρούτσικος & Δημήτρης Μητροπάνος | 20-Apr-2018 16:20 | - | |
|
ПроWода | 20-Apr-2018 16:20 | - | |
|
סאבלימינל | 20-Apr-2018 16:20 | - | |
|
イヴニング娘。 | 20-Apr-2018 16:20 | - | |
|
佐々木勉 | 20-Apr-2018 16:20 | - | |
|
印度草 | 20-Apr-2018 16:20 | - | |
|
皆本光一 starring 中村悠一 | 20-Apr-2018 16:20 | - | |